C15H14ClNO — CID 3689001
7-chloro-2-(3-methoxyphenyl)-2,3-dihydro-1H-indole (PubChem CID 3689001) has the molecular formula C15H14ClNO and a molecular weight of 259.74 g/mol. Its IUPAC name is 7-chloro-2-(3-methoxyphenyl)-2,3-dihydro-1H-indole.
| Compound Name | 7-chloro-2-(3-methoxyphenyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 3689001 |
| Molecular Formula | C15H14ClNO |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 7-chloro-2-(3-methoxyphenyl)-2,3-dihydro-1H-indole |
| SMILES | COc1cccc(C2Cc3cccc(Cl)c3N2)c1 |
| InChI | InChI=1S/C15H14ClNO/c1-18-12-6-2-4-10(8-12)14-9-11-5-3-7-13(16)15(11)17-14/h2-8,14,17H,9H2,1H3 |
| InChIKey | KFDZRLDPUMGFCS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |