C12H13NO3 — CID 83822055
6-(3-methoxyphenyl)piperidine-2,4-dione (PubChem CID 83822055) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)piperidine-2,4-dione.
| Compound Name | 6-(3-methoxyphenyl)piperidine-2,4-dione |
|---|---|
| PubChem CID | 83822055 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 6-(3-methoxyphenyl)piperidine-2,4-dione |
| SMILES | COc1cccc(C2CC(=O)CC(=O)N2)c1 |
| InChI | InChI=1S/C12H13NO3/c1-16-10-4-2-3-8(5-10)11-6-9(14)7-12(15)13-11/h2-5,11H,6-7H2,1H3,(H,13,15) |
| InChIKey | HPCOGYRAMXNQNA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|