C11H10BrNO2 — CID 83825931
6-(3-bromophenyl)piperidine-2,4-dione (PubChem CID 83825931) has the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. Its IUPAC name is 6-(3-bromophenyl)piperidine-2,4-dione.
| Compound Name | 6-(3-bromophenyl)piperidine-2,4-dione |
|---|---|
| PubChem CID | 83825931 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 6-(3-bromophenyl)piperidine-2,4-dione |
| SMILES | O=C1CC(=O)NC(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C11H10BrNO2/c12-8-3-1-2-7(4-8)10-5-9(14)6-11(15)13-10/h1-4,10H,5-6H2,(H,13,15) |
| InChIKey | FVXVYTIWHFTHHJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|