C13H15NO3 — CID 79317793
4-(3-methoxyphenyl)-3-methylpiperidine-2,6-dione (PubChem CID 79317793) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-3-methylpiperidine-2,6-dione.
| Compound Name | 4-(3-methoxyphenyl)-3-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 79317793 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 4-(3-methoxyphenyl)-3-methylpiperidine-2,6-dione |
| SMILES | COc1cccc(C2CC(=O)NC(=O)C2C)c1 |
| InChI | InChI=1S/C13H15NO3/c1-8-11(7-12(15)14-13(8)16)9-4-3-5-10(6-9)17-2/h3-6,8,11H,7H2,1-2H3,(H,14,15,16) |
| InChIKey | UADPIVPYOZPJGT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|