C13H15NO4 — CID 134409869
methyl (4S)-4-(3-methoxyphenyl)-2-oxopyrrolidine-3-carboxylate (PubChem CID 134409869) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is methyl (4S)-4-(3-methoxyphenyl)-2-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl (4S)-4-(3-methoxyphenyl)-2-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 134409869 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | methyl (4S)-4-(3-methoxyphenyl)-2-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1C(=O)NC[C@@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C13H15NO4/c1-17-9-5-3-4-8(6-9)10-7-14-12(15)11(10)13(16)18-2/h3-6,10-11H,7H2,1-2H3,(H,14,15)/t10-,11?/m1/s1 |
| InChIKey | NDXWGCYNGONDTD-NFJWQWPMSA-N |
| XLogP | 0.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|