methyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate

C14H19NO3 — CID 99942655

IUPACmethyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate
SMILESCOC(=O)[C@H]1CNC[C@@H](c2cccc(OC)c2)C1
InChIInChI=1S/C14H19NO3/c1-17-13-5-3-4-10(7-13)11-6-12(9-15-8-11)14(16)18-2/h3-5,7,11-12,15H,6,8-9H2,1-2H3/t11-,12+/m0/s1
InChIKeyKJPUEJXQNOKFSV-NWDGAFQWSA-N
MW249.31 g/mol
LogP1.56
Rot. Bonds3

About methyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate

methyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate (PubChem CID 99942655) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is methyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate.

Molecular Properties

Compound Namemethyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate
PubChem CID99942655
Molecular FormulaC14H19NO3
Molecular Weight249.31 g/mol
Exact Mass249.14
IUPAC Namemethyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate
SMILESCOC(=O)[C@H]1CNC[C@@H](c2cccc(OC)c2)C1
InChIInChI=1S/C14H19NO3/c1-17-13-5-3-4-10(7-13)11-6-12(9-15-8-11)14(16)18-2/h3-5,7,11-12,15H,6,8-9H2,1-2H3/t11-,12+/m0/s1
InChIKeyKJPUEJXQNOKFSV-NWDGAFQWSA-N
XLogP1.56
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.31
LogP ≤ 51.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate?
The IUPAC name of methyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate (CID 99942655) is methyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate.
What is the SMILES notation for methyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate?
The canonical SMILES for methyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate is COC(=O)[C@H]1CNC[C@@H](c2cccc(OC)c2)C1.
What is the InChIKey of methyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate?
The InChIKey is KJPUEJXQNOKFSV-NWDGAFQWSA-N. The full InChI is InChI=1S/C14H19NO3/c1-17-13-5-3-4-10(7-13)11-6-12(9-15-8-11)14(16)18-2/h3-5,7,11-12,15H,6,8-9H2,1-2H3/t11-,12+/m0/s1.
What are the key properties of methyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate?
methyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate has a molecular weight of 249.31 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R,5R)-5-(3-methoxyphenyl)piperidine-3-carboxylate is sourced from PubChem (CID 99942655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).