C14H20ClNO3 — CID 91798826
methyl 4-(3-methoxyphenyl)piperidine-3-carboxylate;hydrochloride (PubChem CID 91798826) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is methyl 4-(3-methoxyphenyl)piperidine-3-carboxylate;hydrochloride.
| Compound Name | methyl 4-(3-methoxyphenyl)piperidine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 91798826 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | methyl 4-(3-methoxyphenyl)piperidine-3-carboxylate;hydrochloride |
| SMILES | COC(=O)C1CNCCC1c1cccc(OC)c1.Cl |
| InChI | InChI=1S/C14H19NO3.ClH/c1-17-11-5-3-4-10(8-11)12-6-7-15-9-13(12)14(16)18-2;/h3-5,8,12-13,15H,6-7,9H2,1-2H3;1H |
| InChIKey | ZUTZILWDTVDOCR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |