C12H15NO3 — CID 129463071
methyl (3S,4S)-4-(3-hydroxyphenyl)pyrrolidine-3-carboxylate (PubChem CID 129463071) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is methyl (3S,4S)-4-(3-hydroxyphenyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl (3S,4S)-4-(3-hydroxyphenyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 129463071 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | methyl (3S,4S)-4-(3-hydroxyphenyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CNC[C@@H]1c1cccc(O)c1 |
| InChI | InChI=1S/C12H15NO3/c1-16-12(15)11-7-13-6-10(11)8-3-2-4-9(14)5-8/h2-5,10-11,13-14H,6-7H2,1H3/t10-,11-/m1/s1 |
| InChIKey | ZINKUFZEYBKMPZ-GHMZBOCLSA-N |
| XLogP | 0.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |