C10H13NO3 — CID 129413863
methyl (3R,4R)-4-(furan-2-yl)pyrrolidine-3-carboxylate (PubChem CID 129413863) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is methyl (3R,4R)-4-(furan-2-yl)pyrrolidine-3-carboxylate.
| Compound Name | methyl (3R,4R)-4-(furan-2-yl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 129413863 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | methyl (3R,4R)-4-(furan-2-yl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CNC[C@@H]1c1ccco1 |
| InChI | InChI=1S/C10H13NO3/c1-13-10(12)8-6-11-5-7(8)9-3-2-4-14-9/h2-4,7-8,11H,5-6H2,1H3/t7-,8-/m0/s1 |
| InChIKey | JHULDCZLFJCRCK-YUMQZZPRSA-N |
| XLogP | 0.76 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |