C9H11NO3 — CID 53398418
4-(furan-2-yl)pyrrolidine-3-carboxylic acid (PubChem CID 53398418) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 4-(furan-2-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | 4-(furan-2-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 53398418 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 4-(furan-2-yl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CNCC1c1ccco1 |
| InChI | InChI=1S/C9H11NO3/c11-9(12)7-5-10-4-6(7)8-2-1-3-13-8/h1-3,6-7,10H,4-5H2,(H,11,12) |
| InChIKey | KMTSLALPZKTAJM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |