C12H15NO2 — CID 7145905
(3R,4R)-4-(4-methylphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 7145905) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (3R,4R)-4-(4-methylphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-(4-methylphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 7145905 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (3R,4R)-4-(4-methylphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | Cc1ccc([C@@H]2CNC[C@@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C12H15NO2/c1-8-2-4-9(5-3-8)10-6-13-7-11(10)12(14)15/h2-5,10-11,13H,6-7H2,1H3,(H,14,15)/t10-,11-/m0/s1 |
| InChIKey | HOMQPSPEVRFBRQ-QWRGUYRKSA-N |
| XLogP | 1.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |