C12H14ClNO2 — CID 129494174
(3S,4S)-4-(2-chloro-4-methylphenyl)pyrrolidine-3-carboxylic acid (PubChem CID 129494174) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is (3S,4S)-4-(2-chloro-4-methylphenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-4-(2-chloro-4-methylphenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 129494174 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | (3S,4S)-4-(2-chloro-4-methylphenyl)pyrrolidine-3-carboxylic acid |
| SMILES | Cc1ccc([C@H]2CNC[C@H]2C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C12H14ClNO2/c1-7-2-3-8(11(13)4-7)9-5-14-6-10(9)12(15)16/h2-4,9-10,14H,5-6H2,1H3,(H,15,16)/t9-,10-/m1/s1 |
| InChIKey | XREWDLFCKDAIMP-NXEZZACHSA-N |
| XLogP | 2.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |