C13H15NO4 — CID 129463108
methyl (3R,4R)-4-(1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylate (PubChem CID 129463108) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is methyl (3R,4R)-4-(1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylate.
| Compound Name | methyl (3R,4R)-4-(1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 129463108 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | methyl (3R,4R)-4-(1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CNC[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H15NO4/c1-16-13(15)10-6-14-5-9(10)8-2-3-11-12(4-8)18-7-17-11/h2-4,9-10,14H,5-7H2,1H3/t9-,10-/m0/s1 |
| InChIKey | VOIMQQPMXXURLO-UWVGGRQHSA-N |
| XLogP | 0.89 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |