C12H14N2O4 — CID 78292346
methyl 5-(1,3-benzodioxol-5-yl)pyrazolidine-3-carboxylate (PubChem CID 78292346) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is methyl 5-(1,3-benzodioxol-5-yl)pyrazolidine-3-carboxylate.
| Compound Name | methyl 5-(1,3-benzodioxol-5-yl)pyrazolidine-3-carboxylate |
|---|---|
| PubChem CID | 78292346 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | methyl 5-(1,3-benzodioxol-5-yl)pyrazolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(c2ccc3c(c2)OCO3)NN1 |
| InChI | InChI=1S/C12H14N2O4/c1-16-12(15)9-5-8(13-14-9)7-2-3-10-11(4-7)18-6-17-10/h2-4,8-9,13-14H,5-6H2,1H3 |
| InChIKey | FXRAOPINBVIJJN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |