C16H20N6O3S — CID 75118908
5-(1,3-benzodioxol-5-yl)-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]pyrazolidine-3-carboxamide (PubChem CID 75118908) has the molecular formula C16H20N6O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]pyrazolidine-3-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 75118908 |
| Molecular Formula | C16H20N6O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]pyrazolidine-3-carboxamide |
| SMILES | Cn1cnnc1SCCNC(=O)C1CC(c2ccc3c(c2)OCO3)NN1 |
| InChI | InChI=1S/C16H20N6O3S/c1-22-8-18-21-16(22)26-5-4-17-15(23)12-7-11(19-20-12)10-2-3-13-14(6-10)25-9-24-13/h2-3,6,8,11-12,19-20H,4-5,7,9H2,1H3,(H,17,23) |
| InChIKey | XLAQORJCRVMYRJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 102.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|