C14H17N5O3S2 — CID 77081042
N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,1-dioxo-3,4-dihydro-2H-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 77081042) has the molecular formula C14H17N5O3S2 and a molecular weight of 367.46 g/mol. Its IUPAC name is N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,1-dioxo-3,4-dihydro-2H-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,1-dioxo-3,4-dihydro-2H-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 77081042 |
| Molecular Formula | C14H17N5O3S2 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,1-dioxo-3,4-dihydro-2H-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | Cn1cnnc1SCCNC(=O)C1Cc2ccccc2S(=O)(=O)N1 |
| InChI | InChI=1S/C14H17N5O3S2/c1-19-9-16-17-14(19)23-7-6-15-13(20)11-8-10-4-2-3-5-12(10)24(21,22)18-11/h2-5,9,11,18H,6-8H2,1H3,(H,15,20) |
| InChIKey | NMRMNDVBWYUFPS-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|