C17H19N5O4S — CID 90512678
1-(1,3-benzodioxole-5-carbonyl)-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]azetidine-3-carboxamide (PubChem CID 90512678) has the molecular formula C17H19N5O4S and a molecular weight of 389.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxole-5-carbonyl)-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]azetidine-3-carboxamide.
| Compound Name | 1-(1,3-benzodioxole-5-carbonyl)-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 90512678 |
| Molecular Formula | C17H19N5O4S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 1-(1,3-benzodioxole-5-carbonyl)-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]azetidine-3-carboxamide |
| SMILES | Cn1cnnc1SCCNC(=O)C1CN(C(=O)c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C17H19N5O4S/c1-21-9-19-20-17(21)27-5-4-18-15(23)12-7-22(8-12)16(24)11-2-3-13-14(6-11)26-10-25-13/h2-3,6,9,12H,4-5,7-8,10H2,1H3,(H,18,23) |
| InChIKey | JVVRWGSBDNDNCC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|