C11H11F3N2O2 — CID 71650916
3-(1,3-benzodioxol-5-yl)-5-(trifluoromethyl)pyrazolidine (PubChem CID 71650916) has the molecular formula C11H11F3N2O2 and a molecular weight of 260.22 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-(trifluoromethyl)pyrazolidine.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-(trifluoromethyl)pyrazolidine |
|---|---|
| PubChem CID | 71650916 |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-(trifluoromethyl)pyrazolidine |
| SMILES | FC(F)(F)C1CC(c2ccc3c(c2)OCO3)NN1 |
| InChI | InChI=1S/C11H11F3N2O2/c12-11(13,14)10-4-7(15-16-10)6-1-2-8-9(3-6)18-5-17-8/h1-3,7,10,15-16H,4-5H2 |
| InChIKey | GXVMGJUBSMPZNW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |