C11H15N3O2 — CID 74796918
3-(1,3-benzodioxol-5-yl)-5-methylpyrazolidin-4-amine (PubChem CID 74796918) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-methylpyrazolidin-4-amine.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-methylpyrazolidin-4-amine |
|---|---|
| PubChem CID | 74796918 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-methylpyrazolidin-4-amine |
| SMILES | CC1NNC(c2ccc3c(c2)OCO3)C1N |
| InChI | InChI=1S/C11H15N3O2/c1-6-10(12)11(14-13-6)7-2-3-8-9(4-7)16-5-15-8/h2-4,6,10-11,13-14H,5,12H2,1H3 |
| InChIKey | RQJLRXDNGVQJPA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |