C12H15NO4S — CID 102569467
2-(1,3-benzodioxol-5-yl)-3-ethylsulfonylcyclopropan-1-amine (PubChem CID 102569467) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3-ethylsulfonylcyclopropan-1-amine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-3-ethylsulfonylcyclopropan-1-amine |
|---|---|
| PubChem CID | 102569467 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3-ethylsulfonylcyclopropan-1-amine |
| SMILES | CCS(=O)(=O)C1C(N)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H15NO4S/c1-2-18(14,15)12-10(11(12)13)7-3-4-8-9(5-7)17-6-16-8/h3-5,10-12H,2,6,13H2,1H3 |
| InChIKey | BWXFFAYEROOJEF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |