C16H21NO5S2 — CID 102569470
2-(1,3-benzodioxol-5-yl)-1-(ethoxymethyl)-3-ethylsulfonylcyclopropane-1-carbothioamide (PubChem CID 102569470) has the molecular formula C16H21NO5S2 and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-(ethoxymethyl)-3-ethylsulfonylcyclopropane-1-carbothioamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-(ethoxymethyl)-3-ethylsulfonylcyclopropane-1-carbothioamide |
|---|---|
| PubChem CID | 102569470 |
| Molecular Formula | C16H21NO5S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-(ethoxymethyl)-3-ethylsulfonylcyclopropane-1-carbothioamide |
| SMILES | CCOCC1(C(N)=S)C(c2ccc3c(c2)OCO3)C1S(=O)(=O)CC |
| InChI | InChI=1S/C16H21NO5S2/c1-3-20-8-16(15(17)23)13(14(16)24(18,19)4-2)10-5-6-11-12(7-10)22-9-21-11/h5-7,13-14H,3-4,8-9H2,1-2H3,(H2,17,23) |
| InChIKey | LDAHIZNWKILVRD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|