C19H18ClNO5S2 — CID 124858266
(1R,2R,3R)-2-(1,3-benzodioxol-5-yl)-3-(4-chlorophenyl)sulfonyl-1-(methoxymethyl)cyclopropane-1-carbothioamide (PubChem CID 124858266) has the molecular formula C19H18ClNO5S2 and a molecular weight of 439.94 g/mol. Its IUPAC name is (1R,2R,3R)-2-(1,3-benzodioxol-5-yl)-3-(4-chlorophenyl)sulfonyl-1-(methoxymethyl)cyclopropane-1-carbothioamide.
| Compound Name | (1R,2R,3R)-2-(1,3-benzodioxol-5-yl)-3-(4-chlorophenyl)sulfonyl-1-(methoxymethyl)cyclopropane-1-carbothioamide |
|---|---|
| PubChem CID | 124858266 |
| Molecular Formula | C19H18ClNO5S2 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | (1R,2R,3R)-2-(1,3-benzodioxol-5-yl)-3-(4-chlorophenyl)sulfonyl-1-(methoxymethyl)cyclopropane-1-carbothioamide |
| SMILES | COC[C@@]1(C(N)=S)[C@H](S(=O)(=O)c2ccc(Cl)cc2)[C@@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H18ClNO5S2/c1-24-9-19(18(21)27)16(11-2-7-14-15(8-11)26-10-25-14)17(19)28(22,23)13-5-3-12(20)4-6-13/h2-8,16-17H,9-10H2,1H3,(H2,21,27)/t16-,17+,19-/m0/s1 |
| InChIKey | MXNGOLUEEXBSTG-SCTDSRPQSA-N |
| XLogP | 2.93 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|