C18H18ClNO3S2 — CID 124744716
(1R,2R,3S)-2-(benzenesulfonyl)-3-(4-chlorophenyl)-1-(methoxymethyl)cyclopropane-1-carbothioamide (PubChem CID 124744716) has the molecular formula C18H18ClNO3S2 and a molecular weight of 395.93 g/mol. Its IUPAC name is (1R,2R,3S)-2-(benzenesulfonyl)-3-(4-chlorophenyl)-1-(methoxymethyl)cyclopropane-1-carbothioamide.
| Compound Name | (1R,2R,3S)-2-(benzenesulfonyl)-3-(4-chlorophenyl)-1-(methoxymethyl)cyclopropane-1-carbothioamide |
|---|---|
| PubChem CID | 124744716 |
| Molecular Formula | C18H18ClNO3S2 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | (1R,2R,3S)-2-(benzenesulfonyl)-3-(4-chlorophenyl)-1-(methoxymethyl)cyclopropane-1-carbothioamide |
| SMILES | COC[C@]1(C(N)=S)[C@H](c2ccc(Cl)cc2)[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18ClNO3S2/c1-23-11-18(17(20)24)15(12-7-9-13(19)10-8-12)16(18)25(21,22)14-5-3-2-4-6-14/h2-10,15-16H,11H2,1H3,(H2,20,24)/t15-,16-,18+/m1/s1 |
| InChIKey | ATUYNZLIYOSOKZ-NUJGCVRESA-N |
| XLogP | 3.20 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|