C18H18FNO3S2 — CID 102570818
2-(benzenesulfonyl)-3-(3-fluorophenyl)-1-(methoxymethyl)cyclopropane-1-carbothioamide (PubChem CID 102570818) has the molecular formula C18H18FNO3S2 and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-(3-fluorophenyl)-1-(methoxymethyl)cyclopropane-1-carbothioamide.
| Compound Name | 2-(benzenesulfonyl)-3-(3-fluorophenyl)-1-(methoxymethyl)cyclopropane-1-carbothioamide |
|---|---|
| PubChem CID | 102570818 |
| Molecular Formula | C18H18FNO3S2 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 2-(benzenesulfonyl)-3-(3-fluorophenyl)-1-(methoxymethyl)cyclopropane-1-carbothioamide |
| SMILES | COCC1(C(N)=S)C(c2cccc(F)c2)C1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18FNO3S2/c1-23-11-18(17(20)24)15(12-6-5-7-13(19)10-12)16(18)25(21,22)14-8-3-2-4-9-14/h2-10,15-16H,11H2,1H3,(H2,20,24) |
| InChIKey | BHZVPGZYJAABEH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|