C13H16FNO3S2 — CID 124747544
(1R,2S,3R)-2-(3-fluorophenyl)-1-(methoxymethyl)-3-methylsulfonylcyclopropane-1-carbothioamide (PubChem CID 124747544) has the molecular formula C13H16FNO3S2 and a molecular weight of 317.41 g/mol. Its IUPAC name is (1R,2S,3R)-2-(3-fluorophenyl)-1-(methoxymethyl)-3-methylsulfonylcyclopropane-1-carbothioamide.
| Compound Name | (1R,2S,3R)-2-(3-fluorophenyl)-1-(methoxymethyl)-3-methylsulfonylcyclopropane-1-carbothioamide |
|---|---|
| PubChem CID | 124747544 |
| Molecular Formula | C13H16FNO3S2 |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (1R,2S,3R)-2-(3-fluorophenyl)-1-(methoxymethyl)-3-methylsulfonylcyclopropane-1-carbothioamide |
| SMILES | COC[C@]1(C(N)=S)[C@H](c2cccc(F)c2)[C@H]1S(C)(=O)=O |
| InChI | InChI=1S/C13H16FNO3S2/c1-18-7-13(12(15)19)10(11(13)20(2,16)17)8-4-3-5-9(14)6-8/h3-6,10-11H,7H2,1-2H3,(H2,15,19)/t10-,11-,13+/m1/s1 |
| InChIKey | SVOMTJUNEIJFKV-WZRBSPASSA-N |
| XLogP | 1.25 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|