C19H20FNO3S2 — CID 124858487
(1R,2R,3R)-2-(4-fluorophenyl)-1-(methoxymethyl)-3-(4-methylphenyl)sulfonylcyclopropane-1-carbothioamide (PubChem CID 124858487) has the molecular formula C19H20FNO3S2 and a molecular weight of 393.51 g/mol. Its IUPAC name is (1R,2R,3R)-2-(4-fluorophenyl)-1-(methoxymethyl)-3-(4-methylphenyl)sulfonylcyclopropane-1-carbothioamide.
| Compound Name | (1R,2R,3R)-2-(4-fluorophenyl)-1-(methoxymethyl)-3-(4-methylphenyl)sulfonylcyclopropane-1-carbothioamide |
|---|---|
| PubChem CID | 124858487 |
| Molecular Formula | C19H20FNO3S2 |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | (1R,2R,3R)-2-(4-fluorophenyl)-1-(methoxymethyl)-3-(4-methylphenyl)sulfonylcyclopropane-1-carbothioamide |
| SMILES | COC[C@@]1(C(N)=S)[C@H](S(=O)(=O)c2ccc(C)cc2)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FNO3S2/c1-12-3-9-15(10-4-12)26(22,23)17-16(13-5-7-14(20)8-6-13)19(17,11-24-2)18(21)25/h3-10,16-17H,11H2,1-2H3,(H2,21,25)/t16-,17+,19-/m0/s1 |
| InChIKey | OZMAUZVDXVMFMQ-SCTDSRPQSA-N |
| XLogP | 2.99 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|