C18H20BrNO3S — CID 102569710
2-(4-bromophenyl)-1-(methoxymethyl)-3-(4-methylphenyl)sulfonylcyclopropan-1-amine (PubChem CID 102569710) has the molecular formula C18H20BrNO3S and a molecular weight of 410.33 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(methoxymethyl)-3-(4-methylphenyl)sulfonylcyclopropan-1-amine.
| Compound Name | 2-(4-bromophenyl)-1-(methoxymethyl)-3-(4-methylphenyl)sulfonylcyclopropan-1-amine |
|---|---|
| PubChem CID | 102569710 |
| Molecular Formula | C18H20BrNO3S |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 2-(4-bromophenyl)-1-(methoxymethyl)-3-(4-methylphenyl)sulfonylcyclopropan-1-amine |
| SMILES | COCC1(N)C(c2ccc(Br)cc2)C1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H20BrNO3S/c1-12-3-9-15(10-4-12)24(21,22)17-16(18(17,20)11-23-2)13-5-7-14(19)8-6-13/h3-10,16-17H,11,20H2,1-2H3 |
| InChIKey | ATAKWQYDVDUMEY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |