C19H22ClNO3S — CID 102570831
2-(4-chlorophenyl)sulfonyl-1-(ethoxymethyl)-3-(4-methylphenyl)cyclopropan-1-amine (PubChem CID 102570831) has the molecular formula C19H22ClNO3S and a molecular weight of 379.91 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-1-(ethoxymethyl)-3-(4-methylphenyl)cyclopropan-1-amine.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-1-(ethoxymethyl)-3-(4-methylphenyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 102570831 |
| Molecular Formula | C19H22ClNO3S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-1-(ethoxymethyl)-3-(4-methylphenyl)cyclopropan-1-amine |
| SMILES | CCOCC1(N)C(c2ccc(C)cc2)C1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClNO3S/c1-3-24-12-19(21)17(14-6-4-13(2)5-7-14)18(19)25(22,23)16-10-8-15(20)9-11-16/h4-11,17-18H,3,12,21H2,1-2H3 |
| InChIKey | BSTHMDPOSYEXJF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |