C17H17Cl2NO3S — CID 102570867
2-(3-chlorophenyl)-3-(4-chlorophenyl)sulfonyl-1-(methoxymethyl)cyclopropan-1-amine (PubChem CID 102570867) has the molecular formula C17H17Cl2NO3S and a molecular weight of 386.30 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3-(4-chlorophenyl)sulfonyl-1-(methoxymethyl)cyclopropan-1-amine.
| Compound Name | 2-(3-chlorophenyl)-3-(4-chlorophenyl)sulfonyl-1-(methoxymethyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 102570867 |
| Molecular Formula | C17H17Cl2NO3S |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 2-(3-chlorophenyl)-3-(4-chlorophenyl)sulfonyl-1-(methoxymethyl)cyclopropan-1-amine |
| SMILES | COCC1(N)C(c2cccc(Cl)c2)C1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2NO3S/c1-23-10-17(20)15(11-3-2-4-13(19)9-11)16(17)24(21,22)14-7-5-12(18)6-8-14/h2-9,15-16H,10,20H2,1H3 |
| InChIKey | WGLSPHQPRTYZED-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |