C18H21ClN2O2S — CID 102570178
[1-(aminomethyl)-2-(3-chlorophenyl)-3-(4-methylphenyl)sulfonylcyclopropyl]methanamine (PubChem CID 102570178) has the molecular formula C18H21ClN2O2S and a molecular weight of 364.90 g/mol. Its IUPAC name is [1-(aminomethyl)-2-(3-chlorophenyl)-3-(4-methylphenyl)sulfonylcyclopropyl]methanamine.
| Compound Name | [1-(aminomethyl)-2-(3-chlorophenyl)-3-(4-methylphenyl)sulfonylcyclopropyl]methanamine |
|---|---|
| PubChem CID | 102570178 |
| Molecular Formula | C18H21ClN2O2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | [1-(aminomethyl)-2-(3-chlorophenyl)-3-(4-methylphenyl)sulfonylcyclopropyl]methanamine |
| SMILES | Cc1ccc(S(=O)(=O)C2C(c3cccc(Cl)c3)C2(CN)CN)cc1 |
| InChI | InChI=1S/C18H21ClN2O2S/c1-12-5-7-15(8-6-12)24(22,23)17-16(18(17,10-20)11-21)13-3-2-4-14(19)9-13/h2-9,16-17H,10-11,20-21H2,1H3 |
| InChIKey | IEWOSWZVKGMLJN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |