C20H25NO3S — CID 102569176
[1-(ethoxymethyl)-2-(4-methylphenyl)sulfonyl-3-phenylcyclopropyl]methanamine (PubChem CID 102569176) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is [1-(ethoxymethyl)-2-(4-methylphenyl)sulfonyl-3-phenylcyclopropyl]methanamine.
| Compound Name | [1-(ethoxymethyl)-2-(4-methylphenyl)sulfonyl-3-phenylcyclopropyl]methanamine |
|---|---|
| PubChem CID | 102569176 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | [1-(ethoxymethyl)-2-(4-methylphenyl)sulfonyl-3-phenylcyclopropyl]methanamine |
| SMILES | CCOCC1(CN)C(c2ccccc2)C1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H25NO3S/c1-3-24-14-20(13-21)18(16-7-5-4-6-8-16)19(20)25(22,23)17-11-9-15(2)10-12-17/h4-12,18-19H,3,13-14,21H2,1-2H3 |
| InChIKey | QXHTUAOMYIUXNN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |