C20H23NO4S — CID 102569168
ethyl 1-(aminomethyl)-2-(4-methylphenyl)sulfonyl-3-phenylcyclopropane-1-carboxylate (PubChem CID 102569168) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is ethyl 1-(aminomethyl)-2-(4-methylphenyl)sulfonyl-3-phenylcyclopropane-1-carboxylate.
| Compound Name | ethyl 1-(aminomethyl)-2-(4-methylphenyl)sulfonyl-3-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 102569168 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | ethyl 1-(aminomethyl)-2-(4-methylphenyl)sulfonyl-3-phenylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(CN)C(c2ccccc2)C1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H23NO4S/c1-3-25-19(22)20(13-21)17(15-7-5-4-6-8-15)18(20)26(23,24)16-11-9-14(2)10-12-16/h4-12,17-18H,3,13,21H2,1-2H3 |
| InChIKey | JVEFSRVRWZLJPV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |