C20H18ClNO4S — CID 102570027
ethyl 2-(3-chlorophenyl)-1-cyano-3-(4-methylphenyl)sulfonylcyclopropane-1-carboxylate (PubChem CID 102570027) has the molecular formula C20H18ClNO4S and a molecular weight of 403.89 g/mol. Its IUPAC name is ethyl 2-(3-chlorophenyl)-1-cyano-3-(4-methylphenyl)sulfonylcyclopropane-1-carboxylate.
| Compound Name | ethyl 2-(3-chlorophenyl)-1-cyano-3-(4-methylphenyl)sulfonylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 102570027 |
| Molecular Formula | C20H18ClNO4S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | ethyl 2-(3-chlorophenyl)-1-cyano-3-(4-methylphenyl)sulfonylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(C#N)C(c2cccc(Cl)c2)C1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H18ClNO4S/c1-3-26-19(23)20(12-22)17(14-5-4-6-15(21)11-14)18(20)27(24,25)16-9-7-13(2)8-10-16/h4-11,17-18H,3H2,1-2H3 |
| InChIKey | HZCSLSGKYHOHNB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |