C21H20ClFO6S — CID 102570328
diethyl 2-(4-chlorophenyl)sulfonyl-3-(3-fluorophenyl)cyclopropane-1,1-dicarboxylate (PubChem CID 102570328) has the molecular formula C21H20ClFO6S and a molecular weight of 454.90 g/mol. Its IUPAC name is diethyl 2-(4-chlorophenyl)sulfonyl-3-(3-fluorophenyl)cyclopropane-1,1-dicarboxylate.
| Compound Name | diethyl 2-(4-chlorophenyl)sulfonyl-3-(3-fluorophenyl)cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102570328 |
| Molecular Formula | C21H20ClFO6S |
| Molecular Weight | 454.90 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | diethyl 2-(4-chlorophenyl)sulfonyl-3-(3-fluorophenyl)cyclopropane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(c2cccc(F)c2)C1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20ClFO6S/c1-3-28-19(24)21(20(25)29-4-2)17(13-6-5-7-15(23)12-13)18(21)30(26,27)16-10-8-14(22)9-11-16/h5-12,17-18H,3-4H2,1-2H3 |
| InChIKey | JIXFFOIWDGJEHI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.90 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|