C15H22ClNO3S — CID 102570451
[2-(3-chlorophenyl)-1-(ethoxymethyl)-3-ethylsulfonylcyclopropyl]methanamine (PubChem CID 102570451) has the molecular formula C15H22ClNO3S and a molecular weight of 331.87 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-1-(ethoxymethyl)-3-ethylsulfonylcyclopropyl]methanamine.
| Compound Name | [2-(3-chlorophenyl)-1-(ethoxymethyl)-3-ethylsulfonylcyclopropyl]methanamine |
|---|---|
| PubChem CID | 102570451 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | [2-(3-chlorophenyl)-1-(ethoxymethyl)-3-ethylsulfonylcyclopropyl]methanamine |
| SMILES | CCOCC1(CN)C(c2cccc(Cl)c2)C1S(=O)(=O)CC |
| InChI | InChI=1S/C15H22ClNO3S/c1-3-20-10-15(9-17)13(14(15)21(18,19)4-2)11-6-5-7-12(16)8-11/h5-8,13-14H,3-4,9-10,17H2,1-2H3 |
| InChIKey | NNSYYNHRRXZOLI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |