C20H22ClNO4S2 — CID 124748806
(1R,2R,3R)-2-(4-chlorophenyl)sulfonyl-1-(ethoxymethyl)-3-(4-methoxyphenyl)cyclopropane-1-carbothioamide (PubChem CID 124748806) has the molecular formula C20H22ClNO4S2 and a molecular weight of 439.99 g/mol. Its IUPAC name is (1R,2R,3R)-2-(4-chlorophenyl)sulfonyl-1-(ethoxymethyl)-3-(4-methoxyphenyl)cyclopropane-1-carbothioamide.
| Compound Name | (1R,2R,3R)-2-(4-chlorophenyl)sulfonyl-1-(ethoxymethyl)-3-(4-methoxyphenyl)cyclopropane-1-carbothioamide |
|---|---|
| PubChem CID | 124748806 |
| Molecular Formula | C20H22ClNO4S2 |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | (1R,2R,3R)-2-(4-chlorophenyl)sulfonyl-1-(ethoxymethyl)-3-(4-methoxyphenyl)cyclopropane-1-carbothioamide |
| SMILES | CCOC[C@@]1(C(N)=S)[C@H](S(=O)(=O)c2ccc(Cl)cc2)[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H22ClNO4S2/c1-3-26-12-20(19(22)27)17(13-4-8-15(25-2)9-5-13)18(20)28(23,24)16-10-6-14(21)7-11-16/h4-11,17-18H,3,12H2,1-2H3,(H2,22,27)/t17-,18+,20-/m0/s1 |
| InChIKey | ZRBWAJFJOXJGTB-NSHGMRRFSA-N |
| XLogP | 3.60 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|