C20H21NO5S2 — CID 124748770
(1R,2R,3R)-2-(benzenesulfonyl)-3-(1,3-benzodioxol-5-yl)-1-(ethoxymethyl)cyclopropane-1-carbothioamide (PubChem CID 124748770) has the molecular formula C20H21NO5S2 and a molecular weight of 419.52 g/mol. Its IUPAC name is (1R,2R,3R)-2-(benzenesulfonyl)-3-(1,3-benzodioxol-5-yl)-1-(ethoxymethyl)cyclopropane-1-carbothioamide.
| Compound Name | (1R,2R,3R)-2-(benzenesulfonyl)-3-(1,3-benzodioxol-5-yl)-1-(ethoxymethyl)cyclopropane-1-carbothioamide |
|---|---|
| PubChem CID | 124748770 |
| Molecular Formula | C20H21NO5S2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | (1R,2R,3R)-2-(benzenesulfonyl)-3-(1,3-benzodioxol-5-yl)-1-(ethoxymethyl)cyclopropane-1-carbothioamide |
| SMILES | CCOC[C@@]1(C(N)=S)[C@H](S(=O)(=O)c2ccccc2)[C@@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H21NO5S2/c1-2-24-11-20(19(21)27)17(13-8-9-15-16(10-13)26-12-25-15)18(20)28(22,23)14-6-4-3-5-7-14/h3-10,17-18H,2,11-12H2,1H3,(H2,21,27)/t17-,18+,20-/m0/s1 |
| InChIKey | ZOHZOSCRVLSLHD-NSHGMRRFSA-N |
| XLogP | 2.66 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|