C18H17NO4S2 — CID 124745046
(1R,2S,3S)-2-(1,3-benzodioxol-5-yl)-3-(4-methylphenyl)sulfonylcyclopropane-1-carbothioamide (PubChem CID 124745046) has the molecular formula C18H17NO4S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (1R,2S,3S)-2-(1,3-benzodioxol-5-yl)-3-(4-methylphenyl)sulfonylcyclopropane-1-carbothioamide.
| Compound Name | (1R,2S,3S)-2-(1,3-benzodioxol-5-yl)-3-(4-methylphenyl)sulfonylcyclopropane-1-carbothioamide |
|---|---|
| PubChem CID | 124745046 |
| Molecular Formula | C18H17NO4S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | (1R,2S,3S)-2-(1,3-benzodioxol-5-yl)-3-(4-methylphenyl)sulfonylcyclopropane-1-carbothioamide |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2[C@H](C(N)=S)[C@H]2c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H17NO4S2/c1-10-2-5-12(6-3-10)25(20,21)17-15(16(17)18(19)24)11-4-7-13-14(8-11)23-9-22-13/h2-8,15-17H,9H2,1H3,(H2,19,24)/t15-,16-,17+/m1/s1 |
| InChIKey | DFDZFDGIGHWDND-ZACQAIPSSA-N |
| XLogP | 2.57 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|