C13H16ClNO2 — CID 131875726
(1R,6S)-6-(1,3-benzodioxol-5-yl)cyclohex-3-en-1-amine;hydrochloride (PubChem CID 131875726) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is (1R,6S)-6-(1,3-benzodioxol-5-yl)cyclohex-3-en-1-amine;hydrochloride.
| Compound Name | (1R,6S)-6-(1,3-benzodioxol-5-yl)cyclohex-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 131875726 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (1R,6S)-6-(1,3-benzodioxol-5-yl)cyclohex-3-en-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CC=CC[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H15NO2.ClH/c14-11-4-2-1-3-10(11)9-5-6-12-13(7-9)16-8-15-12;/h1-2,5-7,10-11H,3-4,8,14H2;1H/t10-,11+;/m0./s1 |
| InChIKey | IHVAAUURGMCWPR-VZXYPILPSA-N |
| XLogP | 2.60 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|