C13H14O4 — CID 53349691
(1S,4S,5R)-5-(1,3-benzodioxol-5-yl)cyclohex-2-ene-1,4-diol (PubChem CID 53349691) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is (1S,4S,5R)-5-(1,3-benzodioxol-5-yl)cyclohex-2-ene-1,4-diol.
| Compound Name | (1S,4S,5R)-5-(1,3-benzodioxol-5-yl)cyclohex-2-ene-1,4-diol |
|---|---|
| PubChem CID | 53349691 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (1S,4S,5R)-5-(1,3-benzodioxol-5-yl)cyclohex-2-ene-1,4-diol |
| SMILES | O[C@@H]1C=C[C@H](O)[C@@H](c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C13H14O4/c14-9-2-3-11(15)10(6-9)8-1-4-12-13(5-8)17-7-16-12/h1-5,9-11,14-15H,6-7H2/t9-,10-,11+/m1/s1 |
| InChIKey | HBKBYPAJHGGNKG-MXWKQRLJSA-N |
| XLogP | 1.18 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|