C15H17NO4 — CID 101462622
N-[(1S,4R,6R)-6-(1,3-benzodioxol-5-yl)-4-hydroxycyclohex-2-en-1-yl]acetamide (PubChem CID 101462622) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is N-[(1S,4R,6R)-6-(1,3-benzodioxol-5-yl)-4-hydroxycyclohex-2-en-1-yl]acetamide.
| Compound Name | N-[(1S,4R,6R)-6-(1,3-benzodioxol-5-yl)-4-hydroxycyclohex-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 101462622 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-[(1S,4R,6R)-6-(1,3-benzodioxol-5-yl)-4-hydroxycyclohex-2-en-1-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C=C[C@H](O)C[C@@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H17NO4/c1-9(17)16-13-4-3-11(18)7-12(13)10-2-5-14-15(6-10)20-8-19-14/h2-6,11-13,18H,7-8H2,1H3,(H,16,17)/t11-,12+,13-/m0/s1 |
| InChIKey | HOUXLHVHLLTNAA-XQQFMLRXSA-N |
| XLogP | 1.32 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|