C23H27NO12 — CID 72695980
[(1R,2S,3S,4S,5R,6S)-2,3,4-triacetyloxy-6-(1,3-benzodioxol-5-yl)-5-(methoxycarbonylamino)cyclohexyl] acetate (PubChem CID 72695980) has the molecular formula C23H27NO12 and a molecular weight of 509.46 g/mol. Its IUPAC name is [(1R,2S,3S,4S,5R,6S)-2,3,4-triacetyloxy-6-(1,3-benzodioxol-5-yl)-5-(methoxycarbonylamino)cyclohexyl] acetate.
| Compound Name | [(1R,2S,3S,4S,5R,6S)-2,3,4-triacetyloxy-6-(1,3-benzodioxol-5-yl)-5-(methoxycarbonylamino)cyclohexyl] acetate |
|---|---|
| PubChem CID | 72695980 |
| Molecular Formula | C23H27NO12 |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | [(1R,2S,3S,4S,5R,6S)-2,3,4-triacetyloxy-6-(1,3-benzodioxol-5-yl)-5-(methoxycarbonylamino)cyclohexyl] acetate |
| SMILES | COC(=O)N[C@H]1[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H27NO12/c1-10(25)33-19-17(14-6-7-15-16(8-14)32-9-31-15)18(24-23(29)30-5)20(34-11(2)26)22(36-13(4)28)21(19)35-12(3)27/h6-8,17-22H,9H2,1-5H3,(H,24,29)/t17-,18+,19+,20-,21-,22-/m0/s1 |
| InChIKey | SOVXMMXNLKDYNR-ZCPXKWAGSA-N |
| XLogP | 0.96 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|