C22H23NO11 — CID 56951274
[(1R,2R,3S,4R,4aR,11bR)-2,3,4-triacetyloxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl] acetate (PubChem CID 56951274) has the molecular formula C22H23NO11 and a molecular weight of 477.42 g/mol. Its IUPAC name is [(1R,2R,3S,4R,4aR,11bR)-2,3,4-triacetyloxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl] acetate.
| Compound Name | [(1R,2R,3S,4R,4aR,11bR)-2,3,4-triacetyloxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl] acetate |
|---|---|
| PubChem CID | 56951274 |
| Molecular Formula | C22H23NO11 |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | [(1R,2R,3S,4R,4aR,11bR)-2,3,4-triacetyloxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]2c3cc4c(cc3C(=O)N[C@H]2[C@H]1OC(C)=O)OCO4 |
| InChI | InChI=1S/C22H23NO11/c1-8(24)31-18-16-12-5-14-15(30-7-29-14)6-13(12)22(28)23-17(16)19(32-9(2)25)21(34-11(4)27)20(18)33-10(3)26/h5-6,16-21H,7H2,1-4H3,(H,23,28)/t16-,17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | QFDOYHJWDVZRDI-UFOPBENGSA-N |
| XLogP | 0.35 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|