C17H19NO6 — CID 11624130
(1R,13R,14S,18R,19S)-19-hydroxy-16,16-dimethyl-5,7,15,17-tetraoxa-12-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),9-trien-11-one (PubChem CID 11624130) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is (1R,13R,14S,18R,19S)-19-hydroxy-16,16-dimethyl-5,7,15,17-tetraoxa-12-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),9-trien-11-one.
| Compound Name | (1R,13R,14S,18R,19S)-19-hydroxy-16,16-dimethyl-5,7,15,17-tetraoxa-12-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),9-trien-11-one |
|---|---|
| PubChem CID | 11624130 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (1R,13R,14S,18R,19S)-19-hydroxy-16,16-dimethyl-5,7,15,17-tetraoxa-12-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),9-trien-11-one |
| SMILES | CC1(C)O[C@H]2[C@@H]3NC(=O)c4cc5c(cc4[C@H]3C[C@H](O)[C@H]2O1)OCO5 |
| InChI | InChI=1S/C17H19NO6/c1-17(2)23-14-10(19)3-8-7-4-11-12(22-6-21-11)5-9(7)16(20)18-13(8)15(14)24-17/h4-5,8,10,13-15,19H,3,6H2,1-2H3,(H,18,20)/t8-,10+,13-,14-,15+/m1/s1 |
| InChIKey | QVWYYXPLQZHYHP-MTVVJKOXSA-N |
| XLogP | 0.90 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |