C16H17NO8 — CID 24777968
methyl (1R,2S,3R,4S,4aR,11bR)-2,3,4-trihydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridine-1-carboxylate (PubChem CID 24777968) has the molecular formula C16H17NO8 and a molecular weight of 351.31 g/mol. Its IUPAC name is methyl (1R,2S,3R,4S,4aR,11bR)-2,3,4-trihydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridine-1-carboxylate.
| Compound Name | methyl (1R,2S,3R,4S,4aR,11bR)-2,3,4-trihydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridine-1-carboxylate |
|---|---|
| PubChem CID | 24777968 |
| Molecular Formula | C16H17NO8 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | methyl (1R,2S,3R,4S,4aR,11bR)-2,3,4-trihydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridine-1-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H]2NC(=O)c3cc4c(cc3[C@H]21)OCO4 |
| InChI | InChI=1S/C16H17NO8/c1-23-16(22)10-9-5-2-7-8(25-4-24-7)3-6(5)15(21)17-11(9)13(19)14(20)12(10)18/h2-3,9-14,18-20H,4H2,1H3,(H,17,21)/t9-,10+,11+,12-,13-,14+/m0/s1 |
| InChIKey | CKERSBMTLFIOCX-ZSOGLFGHSA-N |
| XLogP | -1.50 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |