C15H17NO8 — CID 53380920
(1S,2S,3R,4S,4aR,11bR)-2,3,4,7-tetrahydroxy-1-(hydroxymethyl)-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-6-one (PubChem CID 53380920) has the molecular formula C15H17NO8 and a molecular weight of 339.30 g/mol. Its IUPAC name is (1S,2S,3R,4S,4aR,11bR)-2,3,4,7-tetrahydroxy-1-(hydroxymethyl)-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-6-one.
| Compound Name | (1S,2S,3R,4S,4aR,11bR)-2,3,4,7-tetrahydroxy-1-(hydroxymethyl)-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
|---|---|
| PubChem CID | 53380920 |
| Molecular Formula | C15H17NO8 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | (1S,2S,3R,4S,4aR,11bR)-2,3,4,7-tetrahydroxy-1-(hydroxymethyl)-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
| SMILES | O=C1N[C@H]2[C@H](O)[C@H](O)[C@@H](O)[C@H](CO)[C@@H]2c2cc3c(c(O)c21)OCO3 |
| InChI | InChI=1S/C15H17NO8/c17-2-5-7-4-1-6-14(24-3-23-6)11(19)8(4)15(22)16-9(7)12(20)13(21)10(5)18/h1,5,7,9-10,12-13,17-21H,2-3H2,(H,16,22)/t5-,7+,9-,10+,12+,13-/m1/s1 |
| InChIKey | NNHFFTNOMJEBKY-VUIPHVFMSA-N |
| XLogP | -1.98 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |