C22H21NO9 — CID 71533609
[(1S,2S,3R,4S,4aR,11bR)-2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl]methyl benzoate (PubChem CID 71533609) has the molecular formula C22H21NO9 and a molecular weight of 443.41 g/mol. Its IUPAC name is [(1S,2S,3R,4S,4aR,11bR)-2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl]methyl benzoate.
| Compound Name | [(1S,2S,3R,4S,4aR,11bR)-2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 71533609 |
| Molecular Formula | C22H21NO9 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | [(1S,2S,3R,4S,4aR,11bR)-2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H]2NC(=O)c3c(cc4c(c3O)OCO4)[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C22H21NO9/c24-16-11(7-30-22(29)9-4-2-1-3-5-9)13-10-6-12-20(32-8-31-12)17(25)14(10)21(28)23-15(13)18(26)19(16)27/h1-6,11,13,15-16,18-19,24-27H,7-8H2,(H,23,28)/t11-,13+,15-,16+,18+,19-/m1/s1 |
| InChIKey | ICMKSMAPEZJQLF-XZCHKOFUSA-N |
| XLogP | -0.11 |
| TPSA | 154.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |