C21H19FN2O8 — CID 75090064
4-fluoro-N-(2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl)benzamide (PubChem CID 75090064) has the molecular formula C21H19FN2O8 and a molecular weight of 446.39 g/mol. Its IUPAC name is 4-fluoro-N-(2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl)benzamide.
| Compound Name | 4-fluoro-N-(2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl)benzamide |
|---|---|
| PubChem CID | 75090064 |
| Molecular Formula | C21H19FN2O8 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 4-fluoro-N-(2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl)benzamide |
| SMILES | O=C(NC1C(O)C(O)C(O)C2NC(=O)c3c(cc4c(c3O)OCO4)C12)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H19FN2O8/c22-8-3-1-7(2-4-8)20(29)23-13-11-9-5-10-19(32-6-31-10)15(25)12(9)21(30)24-14(11)17(27)18(28)16(13)26/h1-5,11,13-14,16-18,25-28H,6H2,(H,23,29)(H,24,30) |
| InChIKey | MFQACLIVXVLZLA-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |