C24H27N3O8 — CID 163748612
N-[(2S,3R,4S,4aR)-2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl]-3-[(dimethylamino)methyl]benzamide (PubChem CID 163748612) has the molecular formula C24H27N3O8 and a molecular weight of 485.49 g/mol. Its IUPAC name is N-[(2S,3R,4S,4aR)-2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl]-3-[(dimethylamino)methyl]benzamide.
| Compound Name | N-[(2S,3R,4S,4aR)-2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl]-3-[(dimethylamino)methyl]benzamide |
|---|---|
| PubChem CID | 163748612 |
| Molecular Formula | C24H27N3O8 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | N-[(2S,3R,4S,4aR)-2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl]-3-[(dimethylamino)methyl]benzamide |
| SMILES | CN(C)Cc1cccc(C(=O)NC2C3c4cc5c(c(O)c4C(=O)N[C@H]3[C@H](O)[C@H](O)[C@H]2O)OCO5)c1 |
| InChI | InChI=1S/C24H27N3O8/c1-27(2)8-10-4-3-5-11(6-10)23(32)25-16-14-12-7-13-22(35-9-34-13)18(28)15(12)24(33)26-17(14)20(30)21(31)19(16)29/h3-7,14,16-17,19-21,28-31H,8-9H2,1-2H3,(H,25,32)(H,26,33)/t14?,16?,17-,19+,20+,21-/m1/s1 |
| InChIKey | LOBGSAQNECRYSC-FBQDLXPNSA-N |
| XLogP | -0.73 |
| TPSA | 160.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |