C18H21NO10 — CID 85141237
(2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl) 3-hydroxybutanoate (PubChem CID 85141237) has the molecular formula C18H21NO10 and a molecular weight of 411.36 g/mol. Its IUPAC name is (2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl) 3-hydroxybutanoate.
| Compound Name | (2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl) 3-hydroxybutanoate |
|---|---|
| PubChem CID | 85141237 |
| Molecular Formula | C18H21NO10 |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (2,3,4,7-tetrahydroxy-6-oxo-2,3,4,4a,5,11b-hexahydro-1H-[1,3]dioxolo[4,5-j]phenanthridin-1-yl) 3-hydroxybutanoate |
| SMILES | CC(O)CC(=O)OC1C(O)C(O)C(O)C2NC(=O)c3c(cc4c(c3O)OCO4)C21 |
| InChI | InChI=1S/C18H21NO10/c1-5(20)2-8(21)29-17-9-6-3-7-16(28-4-27-7)12(22)10(6)18(26)19-11(9)13(23)14(24)15(17)25/h3,5,9,11,13-15,17,20,22-25H,2,4H2,1H3,(H,19,26) |
| InChIKey | ZHHCZHUMIUUUGR-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 175.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |